C13H20N4S — CID 133453685
2-(4-but-3-ynylpiperazin-1-yl)-5-propyl-1,3,4-thiadiazole (PubChem CID 133453685) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 2-(4-but-3-ynylpiperazin-1-yl)-5-propyl-1,3,4-thiadiazole.
| Compound Name | 2-(4-but-3-ynylpiperazin-1-yl)-5-propyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 133453685 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-(4-but-3-ynylpiperazin-1-yl)-5-propyl-1,3,4-thiadiazole |
| SMILES | C#CCCN1CCN(c2nnc(CCC)s2)CC1 |
| InChI | InChI=1S/C13H20N4S/c1-3-5-7-16-8-10-17(11-9-16)13-15-14-12(18-13)6-4-2/h1H,4-11H2,2H3 |
| InChIKey | ATOYPFOJGBTDCC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|