C13H18N4O2 — CID 133454804
4-[methyl-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]pyridine-3-carboxamide (PubChem CID 133454804) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[methyl-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]pyridine-3-carboxamide.
| Compound Name | 4-[methyl-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133454804 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-[methyl-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]pyridine-3-carboxamide |
| SMILES | CN(CCN1CCCC1=O)c1ccncc1C(N)=O |
| InChI | InChI=1S/C13H18N4O2/c1-16(7-8-17-6-2-3-12(17)18)11-4-5-15-9-10(11)13(14)19/h4-5,9H,2-3,6-8H2,1H3,(H2,14,19) |
| InChIKey | STXLLZOFFAITBQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |