C20H21N3O2S2 — CID 133455687
2-[3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-1,3-benzothiazole (PubChem CID 133455687) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 133455687 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-[3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-1,3-benzothiazole |
| SMILES | O=S(=O)(C1CCCN(c2nc3ccccc3s2)C1)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H21N3O2S2/c24-27(25,23-13-11-15-6-1-3-9-18(15)23)16-7-5-12-22(14-16)20-21-17-8-2-4-10-19(17)26-20/h1-4,6,8-10,16H,5,7,11-14H2 |
| InChIKey | HUERALQTMWMDEP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |