C22H24N4O2S — CID 133455730
4-[3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-5-methylquinazoline (PubChem CID 133455730) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 4-[3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-5-methylquinazoline.
| Compound Name | 4-[3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-5-methylquinazoline |
|---|---|
| PubChem CID | 133455730 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 4-[3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-5-methylquinazoline |
| SMILES | Cc1cccc2ncnc(N3CCCC(S(=O)(=O)N4CCc5ccccc54)C3)c12 |
| InChI | InChI=1S/C22H24N4O2S/c1-16-6-4-9-19-21(16)22(24-15-23-19)25-12-5-8-18(14-25)29(27,28)26-13-11-17-7-2-3-10-20(17)26/h2-4,6-7,9-10,15,18H,5,8,11-14H2,1H3 |
| InChIKey | JYUZCUMFOWVCPN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |