C23H29N7O — CID 128990617
5-(4-methylpiperazin-1-yl)-2-[1-(5-methylquinazolin-4-yl)piperidin-3-yl]pyridazin-3-one (PubChem CID 128990617) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)-2-[1-(5-methylquinazolin-4-yl)piperidin-3-yl]pyridazin-3-one.
| Compound Name | 5-(4-methylpiperazin-1-yl)-2-[1-(5-methylquinazolin-4-yl)piperidin-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 128990617 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)-2-[1-(5-methylquinazolin-4-yl)piperidin-3-yl]pyridazin-3-one |
| SMILES | Cc1cccc2ncnc(N3CCCC(n4ncc(N5CCN(C)CC5)cc4=O)C3)c12 |
| InChI | InChI=1S/C23H29N7O/c1-17-5-3-7-20-22(17)23(25-16-24-20)29-8-4-6-18(15-29)30-21(31)13-19(14-26-30)28-11-9-27(2)10-12-28/h3,5,7,13-14,16,18H,4,6,8-12,15H2,1-2H3 |
| InChIKey | RPFWGLZZIGCYJD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |