C18H16F2N2O2 — CID 133457376
4-acetyl-2-[[3-(2,2-difluoroethoxy)phenyl]methylamino]benzonitrile (PubChem CID 133457376) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is 4-acetyl-2-[[3-(2,2-difluoroethoxy)phenyl]methylamino]benzonitrile.
| Compound Name | 4-acetyl-2-[[3-(2,2-difluoroethoxy)phenyl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 133457376 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-acetyl-2-[[3-(2,2-difluoroethoxy)phenyl]methylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)c(NCc2cccc(OCC(F)F)c2)c1 |
| InChI | InChI=1S/C18H16F2N2O2/c1-12(23)14-5-6-15(9-21)17(8-14)22-10-13-3-2-4-16(7-13)24-11-18(19)20/h2-8,18,22H,10-11H2,1H3 |
| InChIKey | VVSVYQIAWDEHHN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |