C19H21N3OS — CID 133457450
4-acetyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propylamino]benzonitrile (PubChem CID 133457450) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-acetyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propylamino]benzonitrile.
| Compound Name | 4-acetyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 133457450 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-acetyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1NCCCc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H21N3OS/c1-13(23)15-9-8-14(12-20)11-17(15)21-10-4-7-19-22-16-5-2-3-6-18(16)24-19/h8-9,11,21H,2-7,10H2,1H3 |
| InChIKey | WPMNZHCLSPIRDS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|