C18H15F3N2O2 — CID 133457809
4-acetyl-2-[2-[2-(trifluoromethyl)phenoxy]ethylamino]benzonitrile (PubChem CID 133457809) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is 4-acetyl-2-[2-[2-(trifluoromethyl)phenoxy]ethylamino]benzonitrile.
| Compound Name | 4-acetyl-2-[2-[2-(trifluoromethyl)phenoxy]ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133457809 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-acetyl-2-[2-[2-(trifluoromethyl)phenoxy]ethylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)c(NCCOc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3N2O2/c1-12(24)13-6-7-14(11-22)16(10-13)23-8-9-25-17-5-3-2-4-15(17)18(19,20)21/h2-7,10,23H,8-9H2,1H3 |
| InChIKey | CKOVKMBGQLMJFR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|