C19H20N2O3 — CID 133456502
4-acetyl-2-[2-(2,5-dimethoxyphenyl)ethylamino]benzonitrile (PubChem CID 133456502) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-acetyl-2-[2-(2,5-dimethoxyphenyl)ethylamino]benzonitrile.
| Compound Name | 4-acetyl-2-[2-(2,5-dimethoxyphenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133456502 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-acetyl-2-[2-(2,5-dimethoxyphenyl)ethylamino]benzonitrile |
| SMILES | COc1ccc(OC)c(CCNc2cc(C(C)=O)ccc2C#N)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-13(22)14-4-5-16(12-20)18(11-14)21-9-8-15-10-17(23-2)6-7-19(15)24-3/h4-7,10-11,21H,8-9H2,1-3H3 |
| InChIKey | COWFWJFJMPVTJU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |