C22H24N2O3 — CID 133458100
4-acetyl-2-[(2-cyclopentyloxy-3-methoxyphenyl)methylamino]benzonitrile (PubChem CID 133458100) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-acetyl-2-[(2-cyclopentyloxy-3-methoxyphenyl)methylamino]benzonitrile.
| Compound Name | 4-acetyl-2-[(2-cyclopentyloxy-3-methoxyphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 133458100 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-acetyl-2-[(2-cyclopentyloxy-3-methoxyphenyl)methylamino]benzonitrile |
| SMILES | COc1cccc(CNc2cc(C(C)=O)ccc2C#N)c1OC1CCCC1 |
| InChI | InChI=1S/C22H24N2O3/c1-15(25)16-10-11-17(13-23)20(12-16)24-14-18-6-5-9-21(26-2)22(18)27-19-7-3-4-8-19/h5-6,9-12,19,24H,3-4,7-8,14H2,1-2H3 |
| InChIKey | ZHPYDYDFTZVFKE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |