C19H17F2N3O — CID 133457838
4-acetyl-3-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]benzonitrile (PubChem CID 133457838) has the molecular formula C19H17F2N3O and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-acetyl-3-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]benzonitrile.
| Compound Name | 4-acetyl-3-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 133457838 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-acetyl-3-[[1-(2,4-difluorophenyl)pyrrolidin-3-yl]amino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C19H17F2N3O/c1-12(25)16-4-2-13(10-22)8-18(16)23-15-6-7-24(11-15)19-5-3-14(20)9-17(19)21/h2-5,8-9,15,23H,6-7,11H2,1H3 |
| InChIKey | VDIHVUAHZMNUGO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |