C19H24ClN5 — CID 133460876
4-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-2-methyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 133460876) has the molecular formula C19H24ClN5 and a molecular weight of 357.89 g/mol. Its IUPAC name is 4-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-2-methyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-2-methyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 133460876 |
| Molecular Formula | C19H24ClN5 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[4-[(6-chloro-3-pyridinyl)methyl]piperazin-1-yl]-2-methyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | Cc1nc2c(c(N3CCN(Cc4ccc(Cl)nc4)CC3)n1)CCCC2 |
| InChI | InChI=1S/C19H24ClN5/c1-14-22-17-5-3-2-4-16(17)19(23-14)25-10-8-24(9-11-25)13-15-6-7-18(20)21-12-15/h6-7,12H,2-5,8-11,13H2,1H3 |
| InChIKey | SVTXFWVJBJHKLJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|