C18H25N5 — CID 133463951
1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 133463951) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 133463951 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 1-[6-(3,5-dimethylpyrazol-1-yl)pyridazin-3-yl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | Cc1cc(C)n(-c2ccc(N3CC(C)C4CCCCC43)nn2)n1 |
| InChI | InChI=1S/C18H25N5/c1-12-11-22(16-7-5-4-6-15(12)16)17-8-9-18(20-19-17)23-14(3)10-13(2)21-23/h8-10,12,15-16H,4-7,11H2,1-3H3 |
| InChIKey | NYPJKKMUOKMRLP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |