C18H18FN7O — CID 133465006
5-ethyl-N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133465006) has the molecular formula C18H18FN7O and a molecular weight of 367.39 g/mol. Its IUPAC name is 5-ethyl-N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-ethyl-N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133465006 |
| Molecular Formula | C18H18FN7O |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-ethyl-N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1cc(NCCCc2nc(-c3ccc(F)cc3)no2)n2ncnc2n1 |
| InChI | InChI=1S/C18H18FN7O/c1-2-14-10-15(26-18(23-14)21-11-22-26)20-9-3-4-16-24-17(25-27-16)12-5-7-13(19)8-6-12/h5-8,10-11,20H,2-4,9H2,1H3 |
| InChIKey | MBCVUUINYRHDMJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|