C15H17Cl2N5O — CID 133465592
5-chloro-4-[4-[(5-chloro-2-pyridinyl)methyl]piperazin-1-yl]-2-methoxypyrimidine (PubChem CID 133465592) has the molecular formula C15H17Cl2N5O and a molecular weight of 354.24 g/mol. Its IUPAC name is 5-chloro-4-[4-[(5-chloro-2-pyridinyl)methyl]piperazin-1-yl]-2-methoxypyrimidine.
| Compound Name | 5-chloro-4-[4-[(5-chloro-2-pyridinyl)methyl]piperazin-1-yl]-2-methoxypyrimidine |
|---|---|
| PubChem CID | 133465592 |
| Molecular Formula | C15H17Cl2N5O |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 5-chloro-4-[4-[(5-chloro-2-pyridinyl)methyl]piperazin-1-yl]-2-methoxypyrimidine |
| SMILES | COc1ncc(Cl)c(N2CCN(Cc3ccc(Cl)cn3)CC2)n1 |
| InChI | InChI=1S/C15H17Cl2N5O/c1-23-15-19-9-13(17)14(20-15)22-6-4-21(5-7-22)10-12-3-2-11(16)8-18-12/h2-3,8-9H,4-7,10H2,1H3 |
| InChIKey | VCRYETBUDLTNTM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |