C16H16ClF3N4 — CID 133465598
1-[(5-chloro-2-pyridinyl)methyl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 133465598) has the molecular formula C16H16ClF3N4 and a molecular weight of 356.78 g/mol. Its IUPAC name is 1-[(5-chloro-2-pyridinyl)methyl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[(5-chloro-2-pyridinyl)methyl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 133465598 |
| Molecular Formula | C16H16ClF3N4 |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-[(5-chloro-2-pyridinyl)methyl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | FC(F)(F)c1cccnc1N1CCN(Cc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C16H16ClF3N4/c17-12-3-4-13(22-10-12)11-23-6-8-24(9-7-23)15-14(16(18,19)20)2-1-5-21-15/h1-5,10H,6-9,11H2 |
| InChIKey | HVUYGVMYHLGBIU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |