C15H15FN6S — CID 133466332
N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 133466332) has the molecular formula C15H15FN6S and a molecular weight of 330.39 g/mol. Its IUPAC name is N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133466332 |
| Molecular Formula | C15H15FN6S |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Fc1ccc(Cc2nnc(NCc3nnc4n3CCC4)s2)cc1 |
| InChI | InChI=1S/C15H15FN6S/c16-11-5-3-10(4-6-11)8-14-20-21-15(23-14)17-9-13-19-18-12-2-1-7-22(12)13/h3-6H,1-2,7-9H2,(H,17,21) |
| InChIKey | VCUSVZZRLMMWRX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |