C14H22N6S — CID 133382927
5-tert-butyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 133382927) has the molecular formula C14H22N6S and a molecular weight of 306.44 g/mol. Its IUPAC name is 5-tert-butyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-tert-butyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133382927 |
| Molecular Formula | C14H22N6S |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 5-tert-butyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)(C)c1nnc(NCc2nnc3n2CCCCC3)s1 |
| InChI | InChI=1S/C14H22N6S/c1-14(2,3)12-18-19-13(21-12)15-9-11-17-16-10-7-5-4-6-8-20(10)11/h4-9H2,1-3H3,(H,15,19) |
| InChIKey | BQWOKIZFXRNRCX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |