C17H23N3O — CID 133466881
6-methyl-N-(3-morpholin-4-ylpropyl)quinolin-4-amine (PubChem CID 133466881) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 6-methyl-N-(3-morpholin-4-ylpropyl)quinolin-4-amine.
| Compound Name | 6-methyl-N-(3-morpholin-4-ylpropyl)quinolin-4-amine |
|---|---|
| PubChem CID | 133466881 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 6-methyl-N-(3-morpholin-4-ylpropyl)quinolin-4-amine |
| SMILES | Cc1ccc2nccc(NCCCN3CCOCC3)c2c1 |
| InChI | InChI=1S/C17H23N3O/c1-14-3-4-16-15(13-14)17(5-7-19-16)18-6-2-8-20-9-11-21-12-10-20/h3-5,7,13H,2,6,8-12H2,1H3,(H,18,19) |
| InChIKey | MGWYXXWGZARQAA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|