C14H11N5O4S — CID 133467885
2-[(4-methoxyphenyl)methyl]-5-(5-nitropyrimidin-2-yl)sulfanyl-1,3,4-oxadiazole (PubChem CID 133467885) has the molecular formula C14H11N5O4S and a molecular weight of 345.34 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-5-(5-nitropyrimidin-2-yl)sulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-5-(5-nitropyrimidin-2-yl)sulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 133467885 |
| Molecular Formula | C14H11N5O4S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-5-(5-nitropyrimidin-2-yl)sulfanyl-1,3,4-oxadiazole |
| SMILES | COc1ccc(Cc2nnc(Sc3ncc([N+](=O)[O-])cn3)o2)cc1 |
| InChI | InChI=1S/C14H11N5O4S/c1-22-11-4-2-9(3-5-11)6-12-17-18-14(23-12)24-13-15-7-10(8-16-13)19(20)21/h2-5,7-8H,6H2,1H3 |
| InChIKey | PLJYPBBOAXQPJY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 117.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|