C13H16N4S — CID 133467966
N-ethyl-N-(2-methylprop-2-enyl)-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine (PubChem CID 133467966) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is N-ethyl-N-(2-methylprop-2-enyl)-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-ethyl-N-(2-methylprop-2-enyl)-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133467966 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-ethyl-N-(2-methylprop-2-enyl)-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
| SMILES | C=C(C)CN(CC)c1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C13H16N4S/c1-4-17(9-10(2)3)13-16-15-12(18-13)11-7-5-6-8-14-11/h5-8H,2,4,9H2,1,3H3 |
| InChIKey | BTAQLIZZMATJDS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|