C8H7N3OS — CID 58504238
(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)methanol (PubChem CID 58504238) has the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. Its IUPAC name is (5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)methanol.
| Compound Name | (5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)methanol |
|---|---|
| PubChem CID | 58504238 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | (5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)methanol |
| SMILES | OCc1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C8H7N3OS/c12-5-7-10-11-8(13-7)6-3-1-2-4-9-6/h1-4,12H,5H2 |
| InChIKey | UWAKZTJPJDCUER-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |