C8H6N4OS — CID 159760576
5-pyridin-2-yl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 159760576) has the molecular formula C8H6N4OS and a molecular weight of 206.23 g/mol. Its IUPAC name is 5-pyridin-2-yl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-pyridin-2-yl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 159760576 |
| Molecular Formula | C8H6N4OS |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 5-pyridin-2-yl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | NC(=O)c1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C8H6N4OS/c9-6(13)8-12-11-7(14-8)5-3-1-2-4-10-5/h1-4H,(H2,9,13) |
| InChIKey | NEVBYRRRRAEHKZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |