C15H20N4S — CID 133468195
N-(3-cyclopentylpropyl)-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine (PubChem CID 133468195) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(3-cyclopentylpropyl)-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133468195 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-(3-cyclopentylpropyl)-5-pyridin-2-yl-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(-c2nnc(NCCCC3CCCC3)s2)nc1 |
| InChI | InChI=1S/C15H20N4S/c1-2-7-12(6-1)8-5-11-17-15-19-18-14(20-15)13-9-3-4-10-16-13/h3-4,9-10,12H,1-2,5-8,11H2,(H,17,19) |
| InChIKey | UAMFGCPTGQSKGL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|