C19H19ClN2O2 — CID 13346828
2-chloro-N-[2-(4,4-dimethyl-3-oxo-1,2-dihydroisoquinolin-1-yl)phenyl]acetamide (PubChem CID 13346828) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-chloro-N-[2-(4,4-dimethyl-3-oxo-1,2-dihydroisoquinolin-1-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[2-(4,4-dimethyl-3-oxo-1,2-dihydroisoquinolin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 13346828 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-chloro-N-[2-(4,4-dimethyl-3-oxo-1,2-dihydroisoquinolin-1-yl)phenyl]acetamide |
| SMILES | CC1(C)C(=O)NC(c2ccccc2NC(=O)CCl)c2ccccc21 |
| InChI | InChI=1S/C19H19ClN2O2/c1-19(2)14-9-5-3-7-12(14)17(22-18(19)24)13-8-4-6-10-15(13)21-16(23)11-20/h3-10,17H,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | HUMJMOLGFNBGQA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|