C14H17IN2O3 — CID 133473641
2-cyclopropyl-N-(4-iodo-2-nitrophenyl)oxan-4-amine (PubChem CID 133473641) has the molecular formula C14H17IN2O3 and a molecular weight of 388.21 g/mol. Its IUPAC name is 2-cyclopropyl-N-(4-iodo-2-nitrophenyl)oxan-4-amine.
| Compound Name | 2-cyclopropyl-N-(4-iodo-2-nitrophenyl)oxan-4-amine |
|---|---|
| PubChem CID | 133473641 |
| Molecular Formula | C14H17IN2O3 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 2-cyclopropyl-N-(4-iodo-2-nitrophenyl)oxan-4-amine |
| SMILES | O=[N+]([O-])c1cc(I)ccc1NC1CCOC(C2CC2)C1 |
| InChI | InChI=1S/C14H17IN2O3/c15-10-3-4-12(13(7-10)17(18)19)16-11-5-6-20-14(8-11)9-1-2-9/h3-4,7,9,11,14,16H,1-2,5-6,8H2 |
| InChIKey | FMIIGDBCHXJPMR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|