C16H24N4O5S — CID 174673473
4-[(4-morpholin-2-ylcyclohexyl)amino]-3-nitrobenzenesulfonamide (PubChem CID 174673473) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-[(4-morpholin-2-ylcyclohexyl)amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(4-morpholin-2-ylcyclohexyl)amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 174673473 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-[(4-morpholin-2-ylcyclohexyl)amino]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC2CCC(C3CNCCO3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H24N4O5S/c17-26(23,24)13-5-6-14(15(9-13)20(21)22)19-12-3-1-11(2-4-12)16-10-18-7-8-25-16/h5-6,9,11-12,16,18-19H,1-4,7-8,10H2,(H2,17,23,24) |
| InChIKey | XGOQZPGIAZSYEV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|