C23H22FN5O3 — CID 133475983
1-[8-fluoro-5-[[6-methyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]ethanone (PubChem CID 133475983) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is 1-[8-fluoro-5-[[6-methyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]ethanone.
| Compound Name | 1-[8-fluoro-5-[[6-methyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]ethanone |
|---|---|
| PubChem CID | 133475983 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-[8-fluoro-5-[[6-methyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]ethanone |
| SMILES | CC(=O)N1CCC(Nc2cc(C)nc(-c3ccc([N+](=O)[O-])cc3)n2)c2ccc(F)cc2C1 |
| InChI | InChI=1S/C23H22FN5O3/c1-14-11-22(27-23(25-14)16-3-6-19(7-4-16)29(31)32)26-21-9-10-28(15(2)30)13-17-12-18(24)5-8-20(17)21/h3-8,11-12,21H,9-10,13H2,1-2H3,(H,25,26,27) |
| InChIKey | MJCFFHDPHDMOLZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|