C18H23FN4O2 — CID 133476224
2-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]-2-(4-fluorophenyl)acetamide (PubChem CID 133476224) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 133476224 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-[[2-tert-butyl-6-(methoxymethyl)pyrimidin-4-yl]amino]-2-(4-fluorophenyl)acetamide |
| SMILES | COCc1cc(NC(C(N)=O)c2ccc(F)cc2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C18H23FN4O2/c1-18(2,3)17-21-13(10-25-4)9-14(23-17)22-15(16(20)24)11-5-7-12(19)8-6-11/h5-9,15H,10H2,1-4H3,(H2,20,24)(H,21,22,23) |
| InChIKey | SWZLIRCMQZICEZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |