C19H29N5O — CID 133477603
6-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethylamino]-N-propylpyridine-3-carboxamide (PubChem CID 133477603) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is 6-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethylamino]-N-propylpyridine-3-carboxamide.
| Compound Name | 6-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethylamino]-N-propylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133477603 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 6-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethylamino]-N-propylpyridine-3-carboxamide |
| SMILES | CCCNC(=O)c1ccc(NC(C)c2cn(C(C)(C)C)nc2C)nc1 |
| InChI | InChI=1S/C19H29N5O/c1-7-10-20-18(25)15-8-9-17(21-11-15)22-13(2)16-12-24(19(4,5)6)23-14(16)3/h8-9,11-13H,7,10H2,1-6H3,(H,20,25)(H,21,22) |
| InChIKey | KFPNHEZHYJEJLN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |