C16H22F2N4O — CID 133477434
N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-(difluoromethoxy)pyridin-2-amine (PubChem CID 133477434) has the molecular formula C16H22F2N4O and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-(difluoromethoxy)pyridin-2-amine.
| Compound Name | N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-(difluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 133477434 |
| Molecular Formula | C16H22F2N4O |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-(difluoromethoxy)pyridin-2-amine |
| SMILES | Cc1nn(C(C)(C)C)cc1C(C)Nc1ccc(OC(F)F)cn1 |
| InChI | InChI=1S/C16H22F2N4O/c1-10(13-9-22(16(3,4)5)21-11(13)2)20-14-7-6-12(8-19-14)23-15(17)18/h6-10,15H,1-5H3,(H,19,20) |
| InChIKey | HPAIDFLPVTXEKR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |