C15H12N2O3 — CID 133477922
3-(3,4-dimethylphenoxy)-4-nitrobenzonitrile (PubChem CID 133477922) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-(3,4-dimethylphenoxy)-4-nitrobenzonitrile.
| Compound Name | 3-(3,4-dimethylphenoxy)-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 133477922 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 3-(3,4-dimethylphenoxy)-4-nitrobenzonitrile |
| SMILES | Cc1ccc(Oc2cc(C#N)ccc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H12N2O3/c1-10-3-5-13(7-11(10)2)20-15-8-12(9-16)4-6-14(15)17(18)19/h3-8H,1-2H3 |
| InChIKey | KMJVCQIAHKUTNR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|