C15H8N4O4 — CID 133478061
4-nitro-3-[4-(1,3,4-oxadiazol-2-yl)phenoxy]benzonitrile (PubChem CID 133478061) has the molecular formula C15H8N4O4 and a molecular weight of 308.25 g/mol. Its IUPAC name is 4-nitro-3-[4-(1,3,4-oxadiazol-2-yl)phenoxy]benzonitrile.
| Compound Name | 4-nitro-3-[4-(1,3,4-oxadiazol-2-yl)phenoxy]benzonitrile |
|---|---|
| PubChem CID | 133478061 |
| Molecular Formula | C15H8N4O4 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-nitro-3-[4-(1,3,4-oxadiazol-2-yl)phenoxy]benzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(Oc2ccc(-c3nnco3)cc2)c1 |
| InChI | InChI=1S/C15H8N4O4/c16-8-10-1-6-13(19(20)21)14(7-10)23-12-4-2-11(3-5-12)15-18-17-9-22-15/h1-7,9H |
| InChIKey | WXSDFBFSEYKOHL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 115.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|