C19H20N4O4S — CID 133479013
4-nitro-3-[(2-piperidin-1-ylsulfonylphenyl)methylamino]benzonitrile (PubChem CID 133479013) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 4-nitro-3-[(2-piperidin-1-ylsulfonylphenyl)methylamino]benzonitrile.
| Compound Name | 4-nitro-3-[(2-piperidin-1-ylsulfonylphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 133479013 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-nitro-3-[(2-piperidin-1-ylsulfonylphenyl)methylamino]benzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(NCc2ccccc2S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H20N4O4S/c20-13-15-8-9-18(23(24)25)17(12-15)21-14-16-6-2-3-7-19(16)28(26,27)22-10-4-1-5-11-22/h2-3,6-9,12,21H,1,4-5,10-11,14H2 |
| InChIKey | CIDBYBAQBPLGAU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|