C24H31N5 — CID 133481242
N-[2-methyl-4-(4-methylpiperazin-1-yl)butan-2-yl]-2-phenylquinazolin-4-amine (PubChem CID 133481242) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is N-[2-methyl-4-(4-methylpiperazin-1-yl)butan-2-yl]-2-phenylquinazolin-4-amine.
| Compound Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)butan-2-yl]-2-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 133481242 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | N-[2-methyl-4-(4-methylpiperazin-1-yl)butan-2-yl]-2-phenylquinazolin-4-amine |
| SMILES | CN1CCN(CCC(C)(C)Nc2nc(-c3ccccc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H31N5/c1-24(2,13-14-29-17-15-28(3)16-18-29)27-23-20-11-7-8-12-21(20)25-22(26-23)19-9-5-4-6-10-19/h4-12H,13-18H2,1-3H3,(H,25,26,27) |
| InChIKey | RBKYNSSRBIPIIU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |