About 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol
2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol (PubChem CID 133482957) has the molecular formula C22H25BrN4O
and a molecular weight of 441.37 g/mol. Its IUPAC name is 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol.
Molecular Properties
| Compound Name | 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol |
| PubChem CID | 133482957 |
| Molecular Formula | C22H25BrN4O |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol |
| SMILES | OC(CN1CCC(CNc2ccnc3cc(Br)cnc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H25BrN4O/c23-18-12-20-22(26-14-18)19(6-9-24-20)25-13-16-7-10-27(11-8-16)15-21(28)17-4-2-1-3-5-17/h1-6,9,12,14,16,21,28H,7-8,10-11,13,15H2,(H,24,25) |
| InChIKey | OBCOSPOAFQJFDF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol?
The IUPAC name of 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol (CID 133482957) is 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol.
What is the SMILES notation for 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol?
The canonical SMILES for 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol is OC(CN1CCC(CNc2ccnc3cc(Br)cnc23)CC1)c1ccccc1.
What is the InChIKey of 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol?
The InChIKey is OBCOSPOAFQJFDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25BrN4O/c23-18-12-20-22(26-14-18)19(6-9-24-20)25-13-16-7-10-27(11-8-16)15-21(28)17-4-2-1-3-5-17/h1-6,9,12,14,16,21,28H,7-8,10-11,13,15H2,(H,24,25).
What are the key properties of 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol?
2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol has a molecular weight of 441.37 g/mol, XLogP of 4.25, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[(7-bromo-1,5-naphthyridin-4-yl)amino]methyl]piperidin-1-yl]-1-phenylethanol is sourced from PubChem (CID 133482957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).