C16H22N2 — CID 133483282
2-(6-methyl-2-pyridinyl)-2-azaspiro[5.5]undec-9-ene (PubChem CID 133483282) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-(6-methyl-2-pyridinyl)-2-azaspiro[5.5]undec-9-ene.
| Compound Name | 2-(6-methyl-2-pyridinyl)-2-azaspiro[5.5]undec-9-ene |
|---|---|
| PubChem CID | 133483282 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-(6-methyl-2-pyridinyl)-2-azaspiro[5.5]undec-9-ene |
| SMILES | Cc1cccc(N2CCCC3(CC=CCC3)C2)n1 |
| InChI | InChI=1S/C16H22N2/c1-14-7-5-8-15(17-14)18-12-6-11-16(13-18)9-3-2-4-10-16/h2-3,5,7-8H,4,6,9-13H2,1H3 |
| InChIKey | UQFATGXHFWICPK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|