C16H13NO6S — CID 133486345
5-(4-methylsulfonyl-2-nitrophenoxy)-2,3-dihydroinden-1-one (PubChem CID 133486345) has the molecular formula C16H13NO6S and a molecular weight of 347.35 g/mol. Its IUPAC name is 5-(4-methylsulfonyl-2-nitrophenoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(4-methylsulfonyl-2-nitrophenoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 133486345 |
| Molecular Formula | C16H13NO6S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 5-(4-methylsulfonyl-2-nitrophenoxy)-2,3-dihydroinden-1-one |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc3c(c2)CCC3=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13NO6S/c1-24(21,22)12-4-7-16(14(9-12)17(19)20)23-11-3-5-13-10(8-11)2-6-15(13)18/h3-5,7-9H,2,6H2,1H3 |
| InChIKey | HQNGYSTUFSAADS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|