C17H15NO6 — CID 133486449
5-(4,5-dimethoxy-2-nitrophenoxy)-2,3-dihydroinden-1-one (PubChem CID 133486449) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 5-(4,5-dimethoxy-2-nitrophenoxy)-2,3-dihydroinden-1-one.
| Compound Name | 5-(4,5-dimethoxy-2-nitrophenoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 133486449 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 5-(4,5-dimethoxy-2-nitrophenoxy)-2,3-dihydroinden-1-one |
| SMILES | COc1cc(Oc2ccc3c(c2)CCC3=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H15NO6/c1-22-16-8-13(18(20)21)15(9-17(16)23-2)24-11-4-5-12-10(7-11)3-6-14(12)19/h4-5,7-9H,3,6H2,1-2H3 |
| InChIKey | BRJNWEWUPKHSKD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|