C14H9BrN2O4 — CID 133486479
5-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,3-dihydroinden-1-one (PubChem CID 133486479) has the molecular formula C14H9BrN2O4 and a molecular weight of 349.14 g/mol. Its IUPAC name is 5-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,3-dihydroinden-1-one.
| Compound Name | 5-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 133486479 |
| Molecular Formula | C14H9BrN2O4 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 5-[(3-bromo-5-nitro-2-pyridinyl)oxy]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(Oc3ncc([N+](=O)[O-])cc3Br)ccc21 |
| InChI | InChI=1S/C14H9BrN2O4/c15-12-6-9(17(19)20)7-16-14(12)21-10-2-3-11-8(5-10)1-4-13(11)18/h2-3,5-7H,1,4H2 |
| InChIKey | MZNOTMORIJIDQR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|