C20H13N7S2 — CID 133488179
5-methyl-1-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)sulfanyl]-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 133488179) has the molecular formula C20H13N7S2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 5-methyl-1-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)sulfanyl]-[1,2,4]triazolo[4,3-a]quinoline.
| Compound Name | 5-methyl-1-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)sulfanyl]-[1,2,4]triazolo[4,3-a]quinoline |
|---|---|
| PubChem CID | 133488179 |
| Molecular Formula | C20H13N7S2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 5-methyl-1-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)sulfanyl]-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | Cc1cc2nnc(Sc3ccc4nnc(-c5ccsc5)n4n3)n2c2ccccc12 |
| InChI | InChI=1S/C20H13N7S2/c1-12-10-17-22-24-20(26(17)15-5-3-2-4-14(12)15)29-18-7-6-16-21-23-19(27(16)25-18)13-8-9-28-11-13/h2-11H,1H3 |
| InChIKey | ZGGKXEWBQBIXCW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |