C14H16N2O6S — CID 133490789
3-(furan-2-yl)-3-(4-methylsulfonyl-2-nitroanilino)propan-1-ol (PubChem CID 133490789) has the molecular formula C14H16N2O6S and a molecular weight of 340.36 g/mol. Its IUPAC name is 3-(furan-2-yl)-3-(4-methylsulfonyl-2-nitroanilino)propan-1-ol.
| Compound Name | 3-(furan-2-yl)-3-(4-methylsulfonyl-2-nitroanilino)propan-1-ol |
|---|---|
| PubChem CID | 133490789 |
| Molecular Formula | C14H16N2O6S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-(furan-2-yl)-3-(4-methylsulfonyl-2-nitroanilino)propan-1-ol |
| SMILES | CS(=O)(=O)c1ccc(NC(CCO)c2ccco2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N2O6S/c1-23(20,21)10-4-5-11(13(9-10)16(18)19)15-12(6-7-17)14-3-2-8-22-14/h2-5,8-9,12,15,17H,6-7H2,1H3 |
| InChIKey | QJHNGOJZNWBKGF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|