About N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine
N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 133490988) has the molecular formula C10H19N3S2
and a molecular weight of 245.42 g/mol. Its IUPAC name is N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 133490988 |
| Molecular Formula | C10H19N3S2 |
| Molecular Weight | 245.42 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CSCCN(C)c1nc(CC(C)C)ns1 |
| InChI | InChI=1S/C10H19N3S2/c1-8(2)7-9-11-10(15-12-9)13(3)5-6-14-4/h8H,5-7H2,1-4H3 |
| InChIKey | AIOBMIOYAPQKNC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine (CID 133490988) is N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine is CSCCN(C)c1nc(CC(C)C)ns1.
What is the InChIKey of N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is AIOBMIOYAPQKNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3S2/c1-8(2)7-9-11-10(15-12-9)13(3)5-6-14-4/h8H,5-7H2,1-4H3.
What are the key properties of N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine?
N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 245.42 g/mol, XLogP of 2.54, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(2-methylpropyl)-N-(2-methylsulfanylethyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 133490988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).