C17H17N7O2S — CID 133492065
9-[[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 133492065) has the molecular formula C17H17N7O2S and a molecular weight of 383.44 g/mol. Its IUPAC name is 9-[[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 9-[[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 133492065 |
| Molecular Formula | C17H17N7O2S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 9-[[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCCC2CNc2ccc3nnc(-c4ccsc4)n3n2)N1 |
| InChI | InChI=1S/C17H17N7O2S/c25-15-17(20-16(26)19-15)6-1-2-11(17)8-18-12-3-4-13-21-22-14(24(13)23-12)10-5-7-27-9-10/h3-5,7,9,11H,1-2,6,8H2,(H,18,23)(H2,19,20,25,26) |
| InChIKey | IQLYIVFGXYSEEP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|