C16H14ClN7S — CID 133494363
6-(4-chlorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 133494363) has the molecular formula C16H14ClN7S and a molecular weight of 371.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 6-(4-chlorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 133494363 |
| Molecular Formula | C16H14ClN7S |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 6-(4-chlorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | Clc1ccc(-c2cn3nc(NC4CCCn5ncnc54)sc3n2)cc1 |
| InChI | InChI=1S/C16H14ClN7S/c17-11-5-3-10(4-6-11)13-8-24-16(21-13)25-15(22-24)20-12-2-1-7-23-14(12)18-9-19-23/h3-6,8-9,12H,1-2,7H2,(H,20,22) |
| InChIKey | LAOFSCKXROAKTF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |