C18H21N5S2 — CID 133494799
3-tert-butyl-5-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1,2,4-thiadiazole (PubChem CID 133494799) has the molecular formula C18H21N5S2 and a molecular weight of 371.54 g/mol. Its IUPAC name is 3-tert-butyl-5-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1,2,4-thiadiazole.
| Compound Name | 3-tert-butyl-5-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133494799 |
| Molecular Formula | C18H21N5S2 |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-tert-butyl-5-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1,2,4-thiadiazole |
| SMILES | C=CCn1c(Sc2nc(C(C)(C)C)ns2)nnc1-c1ccccc1C |
| InChI | InChI=1S/C18H21N5S2/c1-6-11-23-14(13-10-8-7-9-12(13)2)20-21-16(23)24-17-19-15(22-25-17)18(3,4)5/h6-10H,1,11H2,2-5H3 |
| InChIKey | XWGHSSYXOFSFRS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|