C13H13FN2O2 — CID 133497405
1-(5-fluoro-1,3-benzoxazol-2-yl)-3-methylpiperidin-4-one (PubChem CID 133497405) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-(5-fluoro-1,3-benzoxazol-2-yl)-3-methylpiperidin-4-one.
| Compound Name | 1-(5-fluoro-1,3-benzoxazol-2-yl)-3-methylpiperidin-4-one |
|---|---|
| PubChem CID | 133497405 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(5-fluoro-1,3-benzoxazol-2-yl)-3-methylpiperidin-4-one |
| SMILES | CC1CN(c2nc3cc(F)ccc3o2)CCC1=O |
| InChI | InChI=1S/C13H13FN2O2/c1-8-7-16(5-4-11(8)17)13-15-10-6-9(14)2-3-12(10)18-13/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | VBILLDNOFYDORN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |