C17H15ClF3N3O4 — CID 133497669
1-(5-chloro-3-nitro-2-pyridinyl)-4-[3-(trifluoromethoxy)phenyl]piperidin-4-ol (PubChem CID 133497669) has the molecular formula C17H15ClF3N3O4 and a molecular weight of 417.77 g/mol. Its IUPAC name is 1-(5-chloro-3-nitro-2-pyridinyl)-4-[3-(trifluoromethoxy)phenyl]piperidin-4-ol.
| Compound Name | 1-(5-chloro-3-nitro-2-pyridinyl)-4-[3-(trifluoromethoxy)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 133497669 |
| Molecular Formula | C17H15ClF3N3O4 |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 1-(5-chloro-3-nitro-2-pyridinyl)-4-[3-(trifluoromethoxy)phenyl]piperidin-4-ol |
| SMILES | O=[N+]([O-])c1cc(Cl)cnc1N1CCC(O)(c2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H15ClF3N3O4/c18-12-9-14(24(26)27)15(22-10-12)23-6-4-16(25,5-7-23)11-2-1-3-13(8-11)28-17(19,20)21/h1-3,8-10,25H,4-7H2 |
| InChIKey | SPAWFTJLUNHDPT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|