C13H17N3O3 — CID 133498252
5-nitro-N-(oxolan-2-ylmethyl)-2,3-dihydro-1H-indol-4-amine (PubChem CID 133498252) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-nitro-N-(oxolan-2-ylmethyl)-2,3-dihydro-1H-indol-4-amine.
| Compound Name | 5-nitro-N-(oxolan-2-ylmethyl)-2,3-dihydro-1H-indol-4-amine |
|---|---|
| PubChem CID | 133498252 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5-nitro-N-(oxolan-2-ylmethyl)-2,3-dihydro-1H-indol-4-amine |
| SMILES | O=[N+]([O-])c1ccc2c(c1NCC1CCCO1)CCN2 |
| InChI | InChI=1S/C13H17N3O3/c17-16(18)12-4-3-11-10(5-6-14-11)13(12)15-8-9-2-1-7-19-9/h3-4,9,14-15H,1-2,5-8H2 |
| InChIKey | SVZOVBKVFUKUMZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|