C15H21N3O3 — CID 100663068
2-[(1S,2R)-2-[(5-nitro-2,3-dihydro-1H-indol-4-yl)amino]cyclopentyl]ethanol (PubChem CID 100663068) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[(1S,2R)-2-[(5-nitro-2,3-dihydro-1H-indol-4-yl)amino]cyclopentyl]ethanol.
| Compound Name | 2-[(1S,2R)-2-[(5-nitro-2,3-dihydro-1H-indol-4-yl)amino]cyclopentyl]ethanol |
|---|---|
| PubChem CID | 100663068 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-[(1S,2R)-2-[(5-nitro-2,3-dihydro-1H-indol-4-yl)amino]cyclopentyl]ethanol |
| SMILES | O=[N+]([O-])c1ccc2c(c1N[C@@H]1CCC[C@H]1CCO)CCN2 |
| InChI | InChI=1S/C15H21N3O3/c19-9-7-10-2-1-3-12(10)17-15-11-6-8-16-13(11)4-5-14(15)18(20)21/h4-5,10,12,16-17,19H,1-3,6-9H2/t10-,12+/m0/s1 |
| InChIKey | VHLMVXVEGARZHD-CMPLNLGQSA-N |
| XLogP | 2.53 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|